C10H18O2 — CID 59801697
3,4-dimethyloctane-2,5-dione (PubChem CID 59801697) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3,4-dimethyloctane-2,5-dione.
| Compound Name | 3,4-dimethyloctane-2,5-dione |
|---|---|
| PubChem CID | 59801697 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3,4-dimethyloctane-2,5-dione |
| SMILES | CCCC(=O)C(C)C(C)C(C)=O |
| InChI | InChI=1S/C10H18O2/c1-5-6-10(12)8(3)7(2)9(4)11/h7-8H,5-6H2,1-4H3 |
| InChIKey | VIGQKZSCQSRPFH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |