C14H24O2 — CID 75298246
6-hydroxy-5,7,9-trimethylundeca-7,9-dien-4-one (PubChem CID 75298246) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 6-hydroxy-5,7,9-trimethylundeca-7,9-dien-4-one.
| Compound Name | 6-hydroxy-5,7,9-trimethylundeca-7,9-dien-4-one |
|---|---|
| PubChem CID | 75298246 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 6-hydroxy-5,7,9-trimethylundeca-7,9-dien-4-one |
| SMILES | CC=C(C)C=C(C)C(O)C(C)C(=O)CCC |
| InChI | InChI=1S/C14H24O2/c1-6-8-13(15)12(5)14(16)11(4)9-10(3)7-2/h7,9,12,14,16H,6,8H2,1-5H3 |
| InChIKey | DVSSWRPHWSGOFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|