About 3-hydroxyheptane-2,4-dione
3-hydroxyheptane-2,4-dione (PubChem CID 102113596) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-hydroxyheptane-2,4-dione.
Molecular Properties
| Compound Name | 3-hydroxyheptane-2,4-dione |
| PubChem CID | 102113596 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-hydroxyheptane-2,4-dione |
| SMILES | CCCC(=O)C(O)C(C)=O |
| InChI | InChI=1S/C7H12O3/c1-3-4-6(9)7(10)5(2)8/h7,10H,3-4H2,1-2H3 |
| InChIKey | KWEAMNKMPMOQPB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyheptane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyheptane-2,4-dione?
The IUPAC name of 3-hydroxyheptane-2,4-dione (CID 102113596) is 3-hydroxyheptane-2,4-dione.
What is the SMILES notation for 3-hydroxyheptane-2,4-dione?
The canonical SMILES for 3-hydroxyheptane-2,4-dione is CCCC(=O)C(O)C(C)=O.
What is the InChIKey of 3-hydroxyheptane-2,4-dione?
The InChIKey is KWEAMNKMPMOQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-6(9)7(10)5(2)8/h7,10H,3-4H2,1-2H3.
What are the key properties of 3-hydroxyheptane-2,4-dione?
3-hydroxyheptane-2,4-dione has a molecular weight of 144.17 g/mol, XLogP of 0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyheptane-2,4-dione is sourced from PubChem (CID 102113596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).