About (3R)-3-bromoheptan-4-one
(3R)-3-bromoheptan-4-one (PubChem CID 86325268) has the molecular formula C7H13BrO
and a molecular weight of 193.08 g/mol. Its IUPAC name is (3R)-3-bromoheptan-4-one.
Molecular Properties
| Compound Name | (3R)-3-bromoheptan-4-one |
| PubChem CID | 86325268 |
| Molecular Formula | C7H13BrO |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | (3R)-3-bromoheptan-4-one |
| SMILES | CCCC(=O)[C@H](Br)CC |
| InChI | InChI=1S/C7H13BrO/c1-3-5-7(9)6(8)4-2/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | SFKVBRLKXVRUQW-ZCFIWIBFSA-N |
| XLogP | 2.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-bromoheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-bromoheptan-4-one?
The IUPAC name of (3R)-3-bromoheptan-4-one (CID 86325268) is (3R)-3-bromoheptan-4-one.
What is the SMILES notation for (3R)-3-bromoheptan-4-one?
The canonical SMILES for (3R)-3-bromoheptan-4-one is CCCC(=O)[C@H](Br)CC.
What is the InChIKey of (3R)-3-bromoheptan-4-one?
The InChIKey is SFKVBRLKXVRUQW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13BrO/c1-3-5-7(9)6(8)4-2/h6H,3-5H2,1-2H3/t6-/m1/s1.
What are the key properties of (3R)-3-bromoheptan-4-one?
(3R)-3-bromoheptan-4-one has a molecular weight of 193.08 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-bromoheptan-4-one is sourced from PubChem (CID 86325268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).