About chromium;2-ethyl-3-oxohexanoic acid
chromium;2-ethyl-3-oxohexanoic acid (PubChem CID 172761906) has the molecular formula C8H14CrO3
and a molecular weight of 210.19 g/mol. Its IUPAC name is chromium;2-ethyl-3-oxohexanoic acid.
Molecular Properties
| Compound Name | chromium;2-ethyl-3-oxohexanoic acid |
| PubChem CID | 172761906 |
| Molecular Formula | C8H14CrO3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | chromium;2-ethyl-3-oxohexanoic acid |
| SMILES | CCCC(=O)C(CC)C(=O)O.[Cr] |
| InChI | InChI=1S/C8H14O3.Cr/c1-3-5-7(9)6(4-2)8(10)11;/h6H,3-5H2,1-2H3,(H,10,11); |
| InChIKey | LUKYUHGLMBSOBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze chromium;2-ethyl-3-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;2-ethyl-3-oxohexanoic acid?
The IUPAC name of chromium;2-ethyl-3-oxohexanoic acid (CID 172761906) is chromium;2-ethyl-3-oxohexanoic acid.
What is the SMILES notation for chromium;2-ethyl-3-oxohexanoic acid?
The canonical SMILES for chromium;2-ethyl-3-oxohexanoic acid is CCCC(=O)C(CC)C(=O)O.[Cr].
What is the InChIKey of chromium;2-ethyl-3-oxohexanoic acid?
The InChIKey is LUKYUHGLMBSOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.Cr/c1-3-5-7(9)6(4-2)8(10)11;/h6H,3-5H2,1-2H3,(H,10,11);.
What are the key properties of chromium;2-ethyl-3-oxohexanoic acid?
chromium;2-ethyl-3-oxohexanoic acid has a molecular weight of 210.19 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-ethyl-3-oxohexanoic acid is sourced from PubChem (CID 172761906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).