2-ethyl-3-oxoicosanoic acid

C22H42O3 — CID 57213641

IUPAC2-ethyl-3-oxoicosanoic acid
SMILESCCCCCCCCCCCCCCCCCC(=O)C(CC)C(=O)O
InChIInChI=1S/C22H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20(4-2)22(24)25/h20H,3-19H2,1-2H3,(H,24,25)
InChIKeyRMQAFGSPWIFZPR-UHFFFAOYSA-N
MW354.58 g/mol
LogP6.93
Rot. Bonds19

About 2-ethyl-3-oxoicosanoic acid

2-ethyl-3-oxoicosanoic acid (PubChem CID 57213641) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2-ethyl-3-oxoicosanoic acid.

Molecular Properties

Compound Name2-ethyl-3-oxoicosanoic acid
PubChem CID57213641
Molecular FormulaC22H42O3
Molecular Weight354.58 g/mol
Exact Mass354.31
IUPAC Name2-ethyl-3-oxoicosanoic acid
SMILESCCCCCCCCCCCCCCCCCC(=O)C(CC)C(=O)O
InChIInChI=1S/C22H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20(4-2)22(24)25/h20H,3-19H2,1-2H3,(H,24,25)
InChIKeyRMQAFGSPWIFZPR-UHFFFAOYSA-N
XLogP6.93
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds19
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500354.58
LogP ≤ 56.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-ethyl-3-oxoicosanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3-oxoicosanoic acid?
The IUPAC name of 2-ethyl-3-oxoicosanoic acid (CID 57213641) is 2-ethyl-3-oxoicosanoic acid.
What is the SMILES notation for 2-ethyl-3-oxoicosanoic acid?
The canonical SMILES for 2-ethyl-3-oxoicosanoic acid is CCCCCCCCCCCCCCCCCC(=O)C(CC)C(=O)O.
What is the InChIKey of 2-ethyl-3-oxoicosanoic acid?
The InChIKey is RMQAFGSPWIFZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20(4-2)22(24)25/h20H,3-19H2,1-2H3,(H,24,25).
What are the key properties of 2-ethyl-3-oxoicosanoic acid?
2-ethyl-3-oxoicosanoic acid has a molecular weight of 354.58 g/mol, XLogP of 6.93, 19 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-oxoicosanoic acid is sourced from PubChem (CID 57213641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).