C24H46O2 — CID 57313364
11-propylhenicosane-10,12-dione (PubChem CID 57313364) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is 11-propylhenicosane-10,12-dione.
| Compound Name | 11-propylhenicosane-10,12-dione |
|---|---|
| PubChem CID | 57313364 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 11-propylhenicosane-10,12-dione |
| SMILES | CCCCCCCCCC(=O)C(CCC)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C24H46O2/c1-4-7-9-11-13-15-17-20-23(25)22(19-6-3)24(26)21-18-16-14-12-10-8-5-2/h22H,4-21H2,1-3H3 |
| InChIKey | FDPVLTGKTBKWPA-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|