C11H21ClNO3+ — CID 95049001
[(1S,3S)-3-carboxy-1-chloro-4-oxoheptyl]-trimethylazanium (PubChem CID 95049001) has the molecular formula C11H21ClNO3+ and a molecular weight of 250.75 g/mol. Its IUPAC name is [(1S,3S)-3-carboxy-1-chloro-4-oxoheptyl]-trimethylazanium.
| Compound Name | [(1S,3S)-3-carboxy-1-chloro-4-oxoheptyl]-trimethylazanium |
|---|---|
| PubChem CID | 95049001 |
| Molecular Formula | C11H21ClNO3+ |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(1S,3S)-3-carboxy-1-chloro-4-oxoheptyl]-trimethylazanium |
| SMILES | CCCC(=O)[C@H](C[C@H](Cl)[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H20ClNO3/c1-5-6-9(14)8(11(15)16)7-10(12)13(2,3)4/h8,10H,5-7H2,1-4H3/p+1/t8-,10+/m0/s1 |
| InChIKey | ZNDDVCUMPVORDL-WCBMZHEXSA-O |
| XLogP | 1.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|