C13H15Br3O — CID 55195228
2-bromo-1-(2,6-dibromo-4-methylphenyl)hexan-3-one (PubChem CID 55195228) has the molecular formula C13H15Br3O and a molecular weight of 426.97 g/mol. Its IUPAC name is 2-bromo-1-(2,6-dibromo-4-methylphenyl)hexan-3-one.
| Compound Name | 2-bromo-1-(2,6-dibromo-4-methylphenyl)hexan-3-one |
|---|---|
| PubChem CID | 55195228 |
| Molecular Formula | C13H15Br3O |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 423.87 |
| IUPAC Name | 2-bromo-1-(2,6-dibromo-4-methylphenyl)hexan-3-one |
| SMILES | CCCC(=O)C(Br)Cc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C13H15Br3O/c1-3-4-13(17)12(16)7-9-10(14)5-8(2)6-11(9)15/h5-6,12H,3-4,7H2,1-2H3 |
| InChIKey | LSHLWVKDWQUFDW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|