About (2S)-2-bromobutanamide
(2S)-2-bromobutanamide (PubChem CID 51414846) has the molecular formula C4H8BrNO
and a molecular weight of 166.02 g/mol. Its IUPAC name is (2S)-2-bromobutanamide.
Molecular Properties
| Compound Name | (2S)-2-bromobutanamide |
| PubChem CID | 51414846 |
| Molecular Formula | C4H8BrNO |
| Molecular Weight | 166.02 g/mol |
| Exact Mass | 164.98 |
| IUPAC Name | (2S)-2-bromobutanamide |
| SMILES | CC[C@H](Br)C(N)=O |
| InChI | InChI=1S/C4H8BrNO/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H2,6,7)/t3-/m0/s1 |
| InChIKey | AKSLRYGHJVUELA-VKHMYHEASA-N |
| XLogP | 0.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.02 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-bromobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-bromobutanamide?
The IUPAC name of (2S)-2-bromobutanamide (CID 51414846) is (2S)-2-bromobutanamide.
What is the SMILES notation for (2S)-2-bromobutanamide?
The canonical SMILES for (2S)-2-bromobutanamide is CC[C@H](Br)C(N)=O.
What is the InChIKey of (2S)-2-bromobutanamide?
The InChIKey is AKSLRYGHJVUELA-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8BrNO/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H2,6,7)/t3-/m0/s1.
What are the key properties of (2S)-2-bromobutanamide?
(2S)-2-bromobutanamide has a molecular weight of 166.02 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-bromobutanamide is sourced from PubChem (CID 51414846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).