About 2-bromobutanoic acid;hydrochloride
2-bromobutanoic acid;hydrochloride (PubChem CID 87779370) has the molecular formula C4H8BrClO2
and a molecular weight of 203.46 g/mol. Its IUPAC name is 2-bromobutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-bromobutanoic acid;hydrochloride |
| PubChem CID | 87779370 |
| Molecular Formula | C4H8BrClO2 |
| Molecular Weight | 203.46 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | 2-bromobutanoic acid;hydrochloride |
| SMILES | CCC(Br)C(=O)O.Cl |
| InChI | InChI=1S/C4H7BrO2.ClH/c1-2-3(5)4(6)7;/h3H,2H2,1H3,(H,6,7);1H |
| InChIKey | HSALRUKTAURWOP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobutanoic acid;hydrochloride?
The IUPAC name of 2-bromobutanoic acid;hydrochloride (CID 87779370) is 2-bromobutanoic acid;hydrochloride.
What is the SMILES notation for 2-bromobutanoic acid;hydrochloride?
The canonical SMILES for 2-bromobutanoic acid;hydrochloride is CCC(Br)C(=O)O.Cl.
What is the InChIKey of 2-bromobutanoic acid;hydrochloride?
The InChIKey is HSALRUKTAURWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrO2.ClH/c1-2-3(5)4(6)7;/h3H,2H2,1H3,(H,6,7);1H.
What are the key properties of 2-bromobutanoic acid;hydrochloride?
2-bromobutanoic acid;hydrochloride has a molecular weight of 203.46 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobutanoic acid;hydrochloride is sourced from PubChem (CID 87779370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).