About 2-bromoacetic acid;2-bromobutanoic acid
2-bromoacetic acid;2-bromobutanoic acid (PubChem CID 161356058) has the molecular formula C6H10Br2O4
and a molecular weight of 305.95 g/mol. Its IUPAC name is 2-bromoacetic acid;2-bromobutanoic acid.
Molecular Properties
| Compound Name | 2-bromoacetic acid;2-bromobutanoic acid |
| PubChem CID | 161356058 |
| Molecular Formula | C6H10Br2O4 |
| Molecular Weight | 305.95 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | 2-bromoacetic acid;2-bromobutanoic acid |
| SMILES | CCC(Br)C(=O)O.O=C(O)CBr |
| InChI | InChI=1S/C4H7BrO2.C2H3BrO2/c1-2-3(5)4(6)7;3-1-2(4)5/h3H,2H2,1H3,(H,6,7);1H2,(H,4,5) |
| InChIKey | VOOFQMYFEWMMQM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.95 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoacetic acid;2-bromobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoacetic acid;2-bromobutanoic acid?
The IUPAC name of 2-bromoacetic acid;2-bromobutanoic acid (CID 161356058) is 2-bromoacetic acid;2-bromobutanoic acid.
What is the SMILES notation for 2-bromoacetic acid;2-bromobutanoic acid?
The canonical SMILES for 2-bromoacetic acid;2-bromobutanoic acid is CCC(Br)C(=O)O.O=C(O)CBr.
What is the InChIKey of 2-bromoacetic acid;2-bromobutanoic acid?
The InChIKey is VOOFQMYFEWMMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrO2.C2H3BrO2/c1-2-3(5)4(6)7;3-1-2(4)5/h3H,2H2,1H3,(H,6,7);1H2,(H,4,5).
What are the key properties of 2-bromoacetic acid;2-bromobutanoic acid?
2-bromoacetic acid;2-bromobutanoic acid has a molecular weight of 305.95 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoacetic acid;2-bromobutanoic acid is sourced from PubChem (CID 161356058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).