About potassium;2-bromoacetic acid;hydride
potassium;2-bromoacetic acid;hydride (PubChem CID 174303508) has the molecular formula C2H4BrKO2
and a molecular weight of 179.05 g/mol. Its IUPAC name is potassium;2-bromoacetic acid;hydride.
Molecular Properties
| Compound Name | potassium;2-bromoacetic acid;hydride |
| PubChem CID | 174303508 |
| Molecular Formula | C2H4BrKO2 |
| Molecular Weight | 179.05 g/mol |
| Exact Mass | 177.90 |
| IUPAC Name | potassium;2-bromoacetic acid;hydride |
| SMILES | O=C(O)CBr.[H-].[K+] |
| InChI | InChI=1S/C2H3BrO2.K.H/c3-1-2(4)5;;/h1H2,(H,4,5);;/q;+1;-1 |
| InChIKey | KCJBBXYLMNWLKV-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.05 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-bromoacetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-bromoacetic acid;hydride?
The IUPAC name of potassium;2-bromoacetic acid;hydride (CID 174303508) is potassium;2-bromoacetic acid;hydride.
What is the SMILES notation for potassium;2-bromoacetic acid;hydride?
The canonical SMILES for potassium;2-bromoacetic acid;hydride is O=C(O)CBr.[H-].[K+].
What is the InChIKey of potassium;2-bromoacetic acid;hydride?
The InChIKey is KCJBBXYLMNWLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrO2.K.H/c3-1-2(4)5;;/h1H2,(H,4,5);;/q;+1;-1.
What are the key properties of potassium;2-bromoacetic acid;hydride?
potassium;2-bromoacetic acid;hydride has a molecular weight of 179.05 g/mol, XLogP of -2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-bromoacetic acid;hydride is sourced from PubChem (CID 174303508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).