About 3-bromopropanoic acid;methane
3-bromopropanoic acid;methane (PubChem CID 87431131) has the molecular formula C4H9BrO2
and a molecular weight of 169.02 g/mol. Its IUPAC name is 3-bromopropanoic acid;methane.
Molecular Properties
| Compound Name | 3-bromopropanoic acid;methane |
| PubChem CID | 87431131 |
| Molecular Formula | C4H9BrO2 |
| Molecular Weight | 169.02 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | 3-bromopropanoic acid;methane |
| SMILES | C.O=C(O)CCBr |
| InChI | InChI=1S/C3H5BrO2.CH4/c4-2-1-3(5)6;/h1-2H2,(H,5,6);1H4 |
| InChIKey | PFGDXIIAGMLCFA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropanoic acid;methane?
The IUPAC name of 3-bromopropanoic acid;methane (CID 87431131) is 3-bromopropanoic acid;methane.
What is the SMILES notation for 3-bromopropanoic acid;methane?
The canonical SMILES for 3-bromopropanoic acid;methane is C.O=C(O)CCBr.
What is the InChIKey of 3-bromopropanoic acid;methane?
The InChIKey is PFGDXIIAGMLCFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrO2.CH4/c4-2-1-3(5)6;/h1-2H2,(H,5,6);1H4.
What are the key properties of 3-bromopropanoic acid;methane?
3-bromopropanoic acid;methane has a molecular weight of 169.02 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropanoic acid;methane is sourced from PubChem (CID 87431131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).