About 2-bromoacetic acid;diiminoazanium
2-bromoacetic acid;diiminoazanium (PubChem CID 174970597) has the molecular formula C2H5BrN3O2+
and a molecular weight of 182.98 g/mol. Its IUPAC name is 2-bromoacetic acid;diiminoazanium.
Molecular Properties
| Compound Name | 2-bromoacetic acid;diiminoazanium |
| PubChem CID | 174970597 |
| Molecular Formula | C2H5BrN3O2+ |
| Molecular Weight | 182.98 g/mol |
| Exact Mass | 181.96 |
| IUPAC Name | 2-bromoacetic acid;diiminoazanium |
| SMILES | N=[N+]=N.O=C(O)CBr |
| InChI | InChI=1S/C2H3BrO2.H2N3/c3-1-2(4)5;1-3-2/h1H2,(H,4,5);1-2H/q;+1 |
| InChIKey | ILUYSZRDYJEEEG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.98 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoacetic acid;diiminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoacetic acid;diiminoazanium?
The IUPAC name of 2-bromoacetic acid;diiminoazanium (CID 174970597) is 2-bromoacetic acid;diiminoazanium.
What is the SMILES notation for 2-bromoacetic acid;diiminoazanium?
The canonical SMILES for 2-bromoacetic acid;diiminoazanium is N=[N+]=N.O=C(O)CBr.
What is the InChIKey of 2-bromoacetic acid;diiminoazanium?
The InChIKey is ILUYSZRDYJEEEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrO2.H2N3/c3-1-2(4)5;1-3-2/h1H2,(H,4,5);1-2H/q;+1.
What are the key properties of 2-bromoacetic acid;diiminoazanium?
2-bromoacetic acid;diiminoazanium has a molecular weight of 182.98 g/mol, XLogP of 0.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoacetic acid;diiminoazanium is sourced from PubChem (CID 174970597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).