(2R)-2-bromoundecanoic acid

C11H21BrO2 — CID 98062248

IUPAC(2R)-2-bromoundecanoic acid
SMILESCCCCCCCCC[C@@H](Br)C(=O)O
InChIInChI=1S/C11H21BrO2/c1-2-3-4-5-6-7-8-9-10(12)11(13)14/h10H,2-9H2,1H3,(H,13,14)/t10-/m1/s1
InChIKeyNOLJPCPMOUBRJN-SNVBAGLBSA-N
MW265.19 g/mol
LogP3.98
Rot. Bonds9

About (2R)-2-bromoundecanoic acid

(2R)-2-bromoundecanoic acid (PubChem CID 98062248) has the molecular formula C11H21BrO2 and a molecular weight of 265.19 g/mol. Its IUPAC name is (2R)-2-bromoundecanoic acid.

Molecular Properties

Compound Name(2R)-2-bromoundecanoic acid
PubChem CID98062248
Molecular FormulaC11H21BrO2
Molecular Weight265.19 g/mol
Exact Mass264.07
IUPAC Name(2R)-2-bromoundecanoic acid
SMILESCCCCCCCCC[C@@H](Br)C(=O)O
InChIInChI=1S/C11H21BrO2/c1-2-3-4-5-6-7-8-9-10(12)11(13)14/h10H,2-9H2,1H3,(H,13,14)/t10-/m1/s1
InChIKeyNOLJPCPMOUBRJN-SNVBAGLBSA-N
XLogP3.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.19
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze (2R)-2-bromoundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-bromoundecanoic acid?
The IUPAC name of (2R)-2-bromoundecanoic acid (CID 98062248) is (2R)-2-bromoundecanoic acid.
What is the SMILES notation for (2R)-2-bromoundecanoic acid?
The canonical SMILES for (2R)-2-bromoundecanoic acid is CCCCCCCCC[C@@H](Br)C(=O)O.
What is the InChIKey of (2R)-2-bromoundecanoic acid?
The InChIKey is NOLJPCPMOUBRJN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H21BrO2/c1-2-3-4-5-6-7-8-9-10(12)11(13)14/h10H,2-9H2,1H3,(H,13,14)/t10-/m1/s1.
What are the key properties of (2R)-2-bromoundecanoic acid?
(2R)-2-bromoundecanoic acid has a molecular weight of 265.19 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-bromoundecanoic acid is sourced from PubChem (CID 98062248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).