About 6,8-dibromotridecan-7-one
6,8-dibromotridecan-7-one (PubChem CID 87601388) has the molecular formula C13H24Br2O
and a molecular weight of 356.14 g/mol. Its IUPAC name is 6,8-dibromotridecan-7-one.
Molecular Properties
| Compound Name | 6,8-dibromotridecan-7-one |
| PubChem CID | 87601388 |
| Molecular Formula | C13H24Br2O |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 6,8-dibromotridecan-7-one |
| SMILES | CCCCCC(Br)C(=O)C(Br)CCCCC |
| InChI | InChI=1S/C13H24Br2O/c1-3-5-7-9-11(14)13(16)12(15)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | RWFVFZBDDGFBKE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dibromotridecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromotridecan-7-one?
The IUPAC name of 6,8-dibromotridecan-7-one (CID 87601388) is 6,8-dibromotridecan-7-one.
What is the SMILES notation for 6,8-dibromotridecan-7-one?
The canonical SMILES for 6,8-dibromotridecan-7-one is CCCCCC(Br)C(=O)C(Br)CCCCC.
What is the InChIKey of 6,8-dibromotridecan-7-one?
The InChIKey is RWFVFZBDDGFBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Br2O/c1-3-5-7-9-11(14)13(16)12(15)10-8-6-4-2/h11-12H,3-10H2,1-2H3.
What are the key properties of 6,8-dibromotridecan-7-one?
6,8-dibromotridecan-7-one has a molecular weight of 356.14 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromotridecan-7-one is sourced from PubChem (CID 87601388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).