About 2-bromododecanoate
2-bromododecanoate (PubChem CID 18519641) has the molecular formula C12H22BrO2-
and a molecular weight of 278.21 g/mol. Its IUPAC name is 2-bromododecanoate.
Molecular Properties
| Compound Name | 2-bromododecanoate |
| PubChem CID | 18519641 |
| Molecular Formula | C12H22BrO2- |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-bromododecanoate |
| SMILES | CCCCCCCCCCC(Br)C(=O)[O-] |
| InChI | InChI=1S/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15)/p-1 |
| InChIKey | HXKXBCBZXXQPPD-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromododecanoate?
The IUPAC name of 2-bromododecanoate (CID 18519641) is 2-bromododecanoate.
What is the SMILES notation for 2-bromododecanoate?
The canonical SMILES for 2-bromododecanoate is CCCCCCCCCCC(Br)C(=O)[O-].
What is the InChIKey of 2-bromododecanoate?
The InChIKey is HXKXBCBZXXQPPD-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15)/p-1.
What are the key properties of 2-bromododecanoate?
2-bromododecanoate has a molecular weight of 278.21 g/mol, XLogP of 3.03, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromododecanoate is sourced from PubChem (CID 18519641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).