C7H14O2 — CID 174458356
2-ethylidenepentane-1,1-diol (PubChem CID 174458356) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-ethylidenepentane-1,1-diol.
| Compound Name | 2-ethylidenepentane-1,1-diol |
|---|---|
| PubChem CID | 174458356 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-ethylidenepentane-1,1-diol |
| SMILES | CC=C(CCC)C(O)O |
| InChI | InChI=1S/C7H14O2/c1-3-5-6(4-2)7(8)9/h4,7-9H,3,5H2,1-2H3 |
| InChIKey | UWEUREQZNXORKD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|