C17H30O — CID 139998521
4,8-di(propan-2-yl)undeca-4,7-dien-6-one (PubChem CID 139998521) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 4,8-di(propan-2-yl)undeca-4,7-dien-6-one.
| Compound Name | 4,8-di(propan-2-yl)undeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 139998521 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 4,8-di(propan-2-yl)undeca-4,7-dien-6-one |
| SMILES | CCCC(=CC(=O)C=C(CCC)C(C)C)C(C)C |
| InChI | InChI=1S/C17H30O/c1-7-9-15(13(3)4)11-17(18)12-16(10-8-2)14(5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | UNNWEZHPJSQMHL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|