About butanoic acid;2-methylpropanoyl chloride
butanoic acid;2-methylpropanoyl chloride (PubChem CID 158101485) has the molecular formula C8H15ClO3
and a molecular weight of 194.66 g/mol. Its IUPAC name is butanoic acid;2-methylpropanoyl chloride.
Molecular Properties
| Compound Name | butanoic acid;2-methylpropanoyl chloride |
| PubChem CID | 158101485 |
| Molecular Formula | C8H15ClO3 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | butanoic acid;2-methylpropanoyl chloride |
| SMILES | CC(C)C(=O)Cl.CCCC(=O)O |
| InChI | InChI=1S/C4H7ClO.C4H8O2/c1-3(2)4(5)6;1-2-3-4(5)6/h3H,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | FPHTWMXYKKNUDI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze butanoic acid;2-methylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;2-methylpropanoyl chloride?
The IUPAC name of butanoic acid;2-methylpropanoyl chloride (CID 158101485) is butanoic acid;2-methylpropanoyl chloride.
What is the SMILES notation for butanoic acid;2-methylpropanoyl chloride?
The canonical SMILES for butanoic acid;2-methylpropanoyl chloride is CC(C)C(=O)Cl.CCCC(=O)O.
What is the InChIKey of butanoic acid;2-methylpropanoyl chloride?
The InChIKey is FPHTWMXYKKNUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO.C4H8O2/c1-3(2)4(5)6;1-2-3-4(5)6/h3H,1-2H3;2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;2-methylpropanoyl chloride?
butanoic acid;2-methylpropanoyl chloride has a molecular weight of 194.66 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;2-methylpropanoyl chloride is sourced from PubChem (CID 158101485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).