C11H18O — CID 177048553
(5Z)-6-propan-2-ylocta-5,7-dien-4-one (PubChem CID 177048553) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (5Z)-6-propan-2-ylocta-5,7-dien-4-one.
| Compound Name | (5Z)-6-propan-2-ylocta-5,7-dien-4-one |
|---|---|
| PubChem CID | 177048553 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (5Z)-6-propan-2-ylocta-5,7-dien-4-one |
| SMILES | C=C/C(=C\C(=O)CCC)C(C)C |
| InChI | InChI=1S/C11H18O/c1-5-7-11(12)8-10(6-2)9(3)4/h6,8-9H,2,5,7H2,1,3-4H3/b10-8+ |
| InChIKey | PZYFUWXKNFPCNJ-CSKARUKUSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|