C11H19N — CID 138459729
(4Z)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine (PubChem CID 138459729) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (4Z)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine.
| Compound Name | (4Z)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 138459729 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (4Z)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(=C\C(N)=C(C)C)C(C)C |
| InChI | InChI=1S/C11H19N/c1-6-10(8(2)3)7-11(12)9(4)5/h6-8H,1,12H2,2-5H3/b10-7+ |
| InChIKey | LSSKJDWBQSBRRD-JXMROGBWSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|