C10H17N — CID 91546308
N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]propan-2-imine (PubChem CID 91546308) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]propan-2-imine.
| Compound Name | N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 91546308 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]propan-2-imine |
| SMILES | C=C/C(=C\N=C(C)C)C(C)C |
| InChI | InChI=1S/C10H17N/c1-6-10(8(2)3)7-11-9(4)5/h6-8H,1H2,2-5H3/b10-7+ |
| InChIKey | QWHDJYCFEISTSL-JXMROGBWSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|