C13H23F — CID 134578289
(3Z)-6-fluoro-5,5,6-trimethyl-3-propan-2-ylhepta-1,3-diene (PubChem CID 134578289) has the molecular formula C13H23F and a molecular weight of 198.32 g/mol. Its IUPAC name is (3Z)-6-fluoro-5,5,6-trimethyl-3-propan-2-ylhepta-1,3-diene.
| Compound Name | (3Z)-6-fluoro-5,5,6-trimethyl-3-propan-2-ylhepta-1,3-diene |
|---|---|
| PubChem CID | 134578289 |
| Molecular Formula | C13H23F |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | (3Z)-6-fluoro-5,5,6-trimethyl-3-propan-2-ylhepta-1,3-diene |
| SMILES | C=C/C(=C\C(C)(C)C(C)(C)F)C(C)C |
| InChI | InChI=1S/C13H23F/c1-8-11(10(2)3)9-12(4,5)13(6,7)14/h8-10H,1H2,2-7H3/b11-9+ |
| InChIKey | XGWRFACVFGNMNX-PKNBQFBNSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|