C10H15F — CID 129119795
(3Z,5Z)-7-fluoro-3-propan-2-ylhepta-1,3,5-triene (PubChem CID 129119795) has the molecular formula C10H15F and a molecular weight of 154.23 g/mol. Its IUPAC name is (3Z,5Z)-7-fluoro-3-propan-2-ylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-fluoro-3-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 129119795 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (3Z,5Z)-7-fluoro-3-propan-2-ylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/CF)C(C)C |
| InChI | InChI=1S/C10H15F/c1-4-10(9(2)3)7-5-6-8-11/h4-7,9H,1,8H2,2-3H3/b6-5-,10-7+ |
| InChIKey | AZOYAUVHUBXFPK-ZZWPSLBBSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|