C15H26 — CID 176935122
(3Z,5E)-6,9-dimethyl-3-propan-2-yldeca-1,3,5-triene (PubChem CID 176935122) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (3Z,5E)-6,9-dimethyl-3-propan-2-yldeca-1,3,5-triene.
| Compound Name | (3Z,5E)-6,9-dimethyl-3-propan-2-yldeca-1,3,5-triene |
|---|---|
| PubChem CID | 176935122 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (3Z,5E)-6,9-dimethyl-3-propan-2-yldeca-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C)CCC(C)C)C(C)C |
| InChI | InChI=1S/C15H26/c1-7-15(13(4)5)11-10-14(6)9-8-12(2)3/h7,10-13H,1,8-9H2,2-6H3/b14-10+,15-11+ |
| InChIKey | GNZBVZLUNGBFAD-WFYKWJGLSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|