C14H24 — CID 91281393
8,11-dimethyldodeca-1,3,7-triene (PubChem CID 91281393) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 8,11-dimethyldodeca-1,3,7-triene.
| Compound Name | 8,11-dimethyldodeca-1,3,7-triene |
|---|---|
| PubChem CID | 91281393 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 8,11-dimethyldodeca-1,3,7-triene |
| SMILES | C=CC=CCCC=C(C)CCC(C)C |
| InChI | InChI=1S/C14H24/c1-5-6-7-8-9-10-14(4)12-11-13(2)3/h5-7,10,13H,1,8-9,11-12H2,2-4H3 |
| InChIKey | RAJSZMMCGMJKGD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|