C16H26 — CID 91474104
8,12-dimethyltetradeca-1,3,8,13-tetraene (PubChem CID 91474104) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 8,12-dimethyltetradeca-1,3,8,13-tetraene.
| Compound Name | 8,12-dimethyltetradeca-1,3,8,13-tetraene |
|---|---|
| PubChem CID | 91474104 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 8,12-dimethyltetradeca-1,3,8,13-tetraene |
| SMILES | C=CC=CCCCC(C)=CCCC(C)C=C |
| InChI | InChI=1S/C16H26/c1-5-7-8-9-10-12-16(4)14-11-13-15(3)6-2/h5-8,14-15H,1-2,9-13H2,3-4H3 |
| InChIKey | HAQHVTUWYJBLTF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|