C13H24O3 — CID 102282318
3-[(2E)-2,6-dimethylocta-2,7-dienoxy]propane-1,2-diol (PubChem CID 102282318) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3-[(2E)-2,6-dimethylocta-2,7-dienoxy]propane-1,2-diol.
| Compound Name | 3-[(2E)-2,6-dimethylocta-2,7-dienoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 102282318 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-[(2E)-2,6-dimethylocta-2,7-dienoxy]propane-1,2-diol |
| SMILES | C=CC(C)CC/C=C(\C)COCC(O)CO |
| InChI | InChI=1S/C13H24O3/c1-4-11(2)6-5-7-12(3)9-16-10-13(15)8-14/h4,7,11,13-15H,1,5-6,8-10H2,2-3H3/b12-7+ |
| InChIKey | OEFFXKRVLHAHSE-KPKJPENVSA-N |
| XLogP | 1.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|