C21H38 — CID 23553717
(4E,8E,12E)-5,9,13,16-tetramethylheptadeca-4,8,12-triene (PubChem CID 23553717) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is (4E,8E,12E)-5,9,13,16-tetramethylheptadeca-4,8,12-triene.
| Compound Name | (4E,8E,12E)-5,9,13,16-tetramethylheptadeca-4,8,12-triene |
|---|---|
| PubChem CID | 23553717 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | (4E,8E,12E)-5,9,13,16-tetramethylheptadeca-4,8,12-triene |
| SMILES | CCC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC(C)C |
| InChI | InChI=1S/C21H38/c1-7-8-11-19(4)12-9-13-20(5)14-10-15-21(6)17-16-18(2)3/h11,13,15,18H,7-10,12,14,16-17H2,1-6H3/b19-11+,20-13+,21-15+ |
| InChIKey | SOXRJKZNPFKIOH-YKBIRWAZSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|