C14H26O — CID 76600828
6,10-dimethyldodeca-5,9-dien-2-ol (PubChem CID 76600828) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 6,10-dimethyldodeca-5,9-dien-2-ol.
| Compound Name | 6,10-dimethyldodeca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 76600828 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 6,10-dimethyldodeca-5,9-dien-2-ol |
| SMILES | CCC(C)=CCCC(C)=CCCC(C)O |
| InChI | InChI=1S/C14H26O/c1-5-12(2)8-6-9-13(3)10-7-11-14(4)15/h8,10,14-15H,5-7,9,11H2,1-4H3 |
| InChIKey | ITVZXAIEJCXPRR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|