C11H22O — CID 156871638
(Z,3S)-3,7-dimethylnon-6-en-1-ol (PubChem CID 156871638) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (Z,3S)-3,7-dimethylnon-6-en-1-ol.
| Compound Name | (Z,3S)-3,7-dimethylnon-6-en-1-ol |
|---|---|
| PubChem CID | 156871638 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (Z,3S)-3,7-dimethylnon-6-en-1-ol |
| SMILES | CC/C(C)=C\CC[C@H](C)CCO |
| InChI | InChI=1S/C11H22O/c1-4-10(2)6-5-7-11(3)8-9-12/h6,11-12H,4-5,7-9H2,1-3H3/b10-6-/t11-/m0/s1 |
| InChIKey | AKGNHAWSXXEAPG-YAEJEKNGSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|