C24H44O2 — CID 174923071
nona-2,6-dien-1-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol (PubChem CID 174923071) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is nona-2,6-dien-1-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol.
| Compound Name | nona-2,6-dien-1-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol |
|---|---|
| PubChem CID | 174923071 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | nona-2,6-dien-1-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)CCO.CCC=CCCC=CCO |
| InChI | InChI=1S/C15H28O.C9H16O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;1-2-3-4-5-6-7-8-9-10/h7,9,15-16H,5-6,8,10-12H2,1-4H3;3-4,7-8,10H,2,5-6,9H2,1H3 |
| InChIKey | VBJLCDSGELFYAM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|