C25H44O2 — CID 174923179
6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol (PubChem CID 174923179) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol.
| Compound Name | 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol |
|---|---|
| PubChem CID | 174923179 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol;3,7,11-trimethyldodeca-6,10-dien-1-ol |
| SMILES | C=C1C(O)CC2CC1C2(C)C.CC(C)=CCCC(C)=CCCC(C)CCO |
| InChI | InChI=1S/C15H28O.C10H16O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;1-6-8-4-7(5-9(6)11)10(8,2)3/h7,9,15-16H,5-6,8,10-12H2,1-4H3;7-9,11H,1,4-5H2,2-3H3 |
| InChIKey | YAYJRZJFMURIBH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|