C11H24O2 — CID 175717951
(Z)-2,6-dimethyloct-2-ene-1,8-diol;methane (PubChem CID 175717951) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (Z)-2,6-dimethyloct-2-ene-1,8-diol;methane.
| Compound Name | (Z)-2,6-dimethyloct-2-ene-1,8-diol;methane |
|---|---|
| PubChem CID | 175717951 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (Z)-2,6-dimethyloct-2-ene-1,8-diol;methane |
| SMILES | C.C/C(=C/CCC(C)CCO)CO |
| InChI | InChI=1S/C10H20O2.CH4/c1-9(6-7-11)4-3-5-10(2)8-12;/h5,9,11-12H,3-4,6-8H2,1-2H3;1H4/b10-5-; |
| InChIKey | ZGKGHIBRXROJBW-WIMVAJRLSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|