C11H22O4S — CID 11218919
[(E)-8-hydroxy-3,7-dimethyloct-6-enyl] methanesulfonate (PubChem CID 11218919) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is [(E)-8-hydroxy-3,7-dimethyloct-6-enyl] methanesulfonate.
| Compound Name | [(E)-8-hydroxy-3,7-dimethyloct-6-enyl] methanesulfonate |
|---|---|
| PubChem CID | 11218919 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(E)-8-hydroxy-3,7-dimethyloct-6-enyl] methanesulfonate |
| SMILES | C/C(=C\CCC(C)CCOS(C)(=O)=O)CO |
| InChI | InChI=1S/C11H22O4S/c1-10(5-4-6-11(2)9-12)7-8-15-16(3,13)14/h6,10,12H,4-5,7-9H2,1-3H3/b11-6+ |
| InChIKey | WCZXOTMPNONIOQ-IZZDOVSWSA-N |
| XLogP | 1.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|