C15H27N — CID 153393660
(3R,6Z)-3-methyl-N-(3-methylbutyl)nona-1,6,8-trien-2-amine (PubChem CID 153393660) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (3R,6Z)-3-methyl-N-(3-methylbutyl)nona-1,6,8-trien-2-amine.
| Compound Name | (3R,6Z)-3-methyl-N-(3-methylbutyl)nona-1,6,8-trien-2-amine |
|---|---|
| PubChem CID | 153393660 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (3R,6Z)-3-methyl-N-(3-methylbutyl)nona-1,6,8-trien-2-amine |
| SMILES | C=C/C=C\CC[C@@H](C)C(=C)NCCC(C)C |
| InChI | InChI=1S/C15H27N/c1-6-7-8-9-10-14(4)15(5)16-12-11-13(2)3/h6-8,13-14,16H,1,5,9-12H2,2-4H3/b8-7-/t14-/m1/s1 |
| InChIKey | INDVIEZIKCTUQY-WBTMPAOCSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|