C9H17N — CID 153204423
N-[(1Z)-buta-1,3-dienyl]-3-methylbutan-1-amine (PubChem CID 153204423) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-3-methylbutan-1-amine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 153204423 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-3-methylbutan-1-amine |
| SMILES | C=C/C=C\NCCC(C)C |
| InChI | InChI=1S/C9H17N/c1-4-5-7-10-8-6-9(2)3/h4-5,7,9-10H,1,6,8H2,2-3H3/b7-5- |
| InChIKey | WKNPTSIRAKVEGH-ALCCZGGFSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|