C15H26 — CID 174724270
bis(buta-1,3-diene);5-methylhex-1-ene (PubChem CID 174724270) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is bis(buta-1,3-diene);5-methylhex-1-ene.
| Compound Name | bis(buta-1,3-diene);5-methylhex-1-ene |
|---|---|
| PubChem CID | 174724270 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | bis(buta-1,3-diene);5-methylhex-1-ene |
| SMILES | C=CC=C.C=CC=C.C=CCCC(C)C |
| InChI | InChI=1S/C7H14.2C4H6/c1-4-5-6-7(2)3;2*1-3-4-2/h4,7H,1,5-6H2,2-3H3;2*3-4H,1-2H2 |
| InChIKey | AKUGDGPRHDLMQI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|