C15H23NO — CID 132536757
(2E,4E,8E)-N-(2-methylpropyl)undeca-2,4,8,10-tetraenamide (PubChem CID 132536757) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (2E,4E,8E)-N-(2-methylpropyl)undeca-2,4,8,10-tetraenamide.
| Compound Name | (2E,4E,8E)-N-(2-methylpropyl)undeca-2,4,8,10-tetraenamide |
|---|---|
| PubChem CID | 132536757 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2E,4E,8E)-N-(2-methylpropyl)undeca-2,4,8,10-tetraenamide |
| SMILES | C=C/C=C/CC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C15H23NO/c1-4-5-6-7-8-9-10-11-12-15(17)16-13-14(2)3/h4-6,9-12,14H,1,7-8,13H2,2-3H3,(H,16,17)/b6-5+,10-9+,12-11+ |
| InChIKey | IUVGLAJTRVISMR-SENBKVFWSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|