C17H29NO — CID 87901236
N-(2-methylpropyl)trideca-2,4,12-trienamide (PubChem CID 87901236) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is N-(2-methylpropyl)trideca-2,4,12-trienamide.
| Compound Name | N-(2-methylpropyl)trideca-2,4,12-trienamide |
|---|---|
| PubChem CID | 87901236 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-(2-methylpropyl)trideca-2,4,12-trienamide |
| SMILES | C=CCCCCCCC=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C17H29NO/c1-4-5-6-7-8-9-10-11-12-13-14-17(19)18-15-16(2)3/h4,11-14,16H,1,5-10,15H2,2-3H3,(H,18,19) |
| InChIKey | HVPYTURTWHZGJP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|