C18H33NO — CID 10731388
(2E,4E)-N-(2-methylpropyl)tetradeca-2,4-dienamide (PubChem CID 10731388) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)tetradeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)tetradeca-2,4-dienamide |
|---|---|
| PubChem CID | 10731388 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)tetradeca-2,4-dienamide |
| SMILES | CCCCCCCCC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C18H33NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(20)19-16-17(2)3/h12-15,17H,4-11,16H2,1-3H3,(H,19,20)/b13-12+,15-14+ |
| InChIKey | AGJAUFUNZWHLKE-SQIWNDBBSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|