C15H27NO — CID 123476396
N-methyltetradeca-2,4-dienamide (PubChem CID 123476396) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-methyltetradeca-2,4-dienamide.
| Compound Name | N-methyltetradeca-2,4-dienamide |
|---|---|
| PubChem CID | 123476396 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-methyltetradeca-2,4-dienamide |
| SMILES | CCCCCCCCCC=CC=CC(=O)NC |
| InChI | InChI=1S/C15H27NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16-2/h11-14H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | BQVYSJMQFBCFOT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|