C11H19NO — CID 87311130
(2E,4Z)-N-methyldeca-2,4-dienamide (PubChem CID 87311130) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E,4Z)-N-methyldeca-2,4-dienamide.
| Compound Name | (2E,4Z)-N-methyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 87311130 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2E,4Z)-N-methyldeca-2,4-dienamide |
| SMILES | CCCCC/C=C\C=C\C(=O)NC |
| InChI | InChI=1S/C11H19NO/c1-3-4-5-6-7-8-9-10-11(13)12-2/h7-10H,3-6H2,1-2H3,(H,12,13)/b8-7-,10-9+ |
| InChIKey | ZVAAYRZGROASHM-UQGDGPGGSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|