C17H31NO — CID 123429480
N-methylhexadeca-2,4-dienamide (PubChem CID 123429480) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N-methylhexadeca-2,4-dienamide.
| Compound Name | N-methylhexadeca-2,4-dienamide |
|---|---|
| PubChem CID | 123429480 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N-methylhexadeca-2,4-dienamide |
| SMILES | CCCCCCCCCCCC=CC=CC(=O)NC |
| InChI | InChI=1S/C17H31NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18-2/h13-16H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | MDMFJMBHVHUYOU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|