C15H27NO — CID 38347217
(2E,4E)-N-[(2R)-2-methylbutyl]deca-2,4-dienamide (PubChem CID 38347217) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2E,4E)-N-[(2R)-2-methylbutyl]deca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2R)-2-methylbutyl]deca-2,4-dienamide |
|---|---|
| PubChem CID | 38347217 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2E,4E)-N-[(2R)-2-methylbutyl]deca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)NC[C@H](C)CC |
| InChI | InChI=1S/C15H27NO/c1-4-6-7-8-9-10-11-12-15(17)16-13-14(3)5-2/h9-12,14H,4-8,13H2,1-3H3,(H,16,17)/b10-9+,12-11+/t14-/m1/s1 |
| InChIKey | DNFXVYXFGYXVTF-HVMMISARSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|