C12H21NO2 — CID 134860994
(2E,4E)-8-hydroxy-N-(2-methylpropyl)octa-2,4-dienamide (PubChem CID 134860994) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,4E)-8-hydroxy-N-(2-methylpropyl)octa-2,4-dienamide.
| Compound Name | (2E,4E)-8-hydroxy-N-(2-methylpropyl)octa-2,4-dienamide |
|---|---|
| PubChem CID | 134860994 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E,4E)-8-hydroxy-N-(2-methylpropyl)octa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCO |
| InChI | InChI=1S/C12H21NO2/c1-11(2)10-13-12(15)8-6-4-3-5-7-9-14/h3-4,6,8,11,14H,5,7,9-10H2,1-2H3,(H,13,15)/b4-3+,8-6+ |
| InChIKey | SPZWSEJNFPLXRN-PBOULFJWSA-N |
| XLogP | 1.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|