C19H33NO2Si — CID 158854274
(2E,4E)-N-(2-methylpropyl)-9-(3-trimethylsilylprop-2-ynoxy)nona-2,4-dienamide (PubChem CID 158854274) has the molecular formula C19H33NO2Si and a molecular weight of 335.56 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-9-(3-trimethylsilylprop-2-ynoxy)nona-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-9-(3-trimethylsilylprop-2-ynoxy)nona-2,4-dienamide |
|---|---|
| PubChem CID | 158854274 |
| Molecular Formula | C19H33NO2Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-9-(3-trimethylsilylprop-2-ynoxy)nona-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCCOCC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H33NO2Si/c1-18(2)17-20-19(21)13-10-8-6-7-9-11-14-22-15-12-16-23(3,4)5/h6,8,10,13,18H,7,9,11,14-15,17H2,1-5H3,(H,20,21)/b8-6+,13-10+ |
| InChIKey | IZVNRHFEKIILLK-YXBXOZLWSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|