C25H34N2O2 — CID 19898632
(2E,4E)-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide (PubChem CID 19898632) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide |
|---|---|
| PubChem CID | 19898632 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCCCCCOc1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H34N2O2/c1-21(2)20-26-24(28)16-10-8-6-4-3-5-7-9-13-19-29-25-18-17-22-14-11-12-15-23(22)27-25/h6,8,10-12,14-18,21H,3-5,7,9,13,19-20H2,1-2H3,(H,26,28)/b8-6+,16-10+ |
| InChIKey | FKQMESAEZDSYMG-XOBDNCQPSA-N |
| XLogP | 5.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|